NC(=O)NC1=CC=CC2=C1C(=O)C1=C(NN=C21)C1CC1

InChIKey=FNFODUHWJAMDEC-UHFFFAOYSA-N

C14H12N4O2

268.276

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones

Aryl ketones

Benzenoids Vinylogous amides Pyrazoles Heteroaromatic compounds Ureas Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteropolycyclic compounds

Aryl ketone - Benzenoid - Azole - Pyrazole - Vinylogous amide - Heteroaromatic compound - Carbonic acid derivative - Urea - Organoheterocyclic compound - Azacycle - Organopnictogen compound - Organic nitrogen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as aryl ketones. These are organic aromatic compounds that contain a ketone group substituted at one C-atom with an aryl group. They have the generic structure RC(=O)R', where R = aryl group and R'=organyl group.

Not available