CCC(=O)OC1CCCCC1NC(=O)CNC(=O)C1=CC(=CC=C1)N=C(N)N

InChIKey=FMRMBWFTGSIDRO-UHFFFAOYSA-N

C19H27N5O4

389.456

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Aminobenzoic acids and derivatives

Guanidinobenzoic acids and derivatives

N-acyl-alpha amino acids and derivatives Hippuric acids and derivatives Alpha amino acid amides Benzoyl derivatives Secondary carboxylic acid amides Guanidines Carboxylic acid esters Propargyl-type 1,3-dipolar organic compounds Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

N-acyl-alpha amino acid or derivatives - Guanidinobenzoic acid or derivatives - Hippuric acid or derivatives - Alpha-amino acid amide - N-substituted-alpha-amino acid - Alpha-amino acid or derivatives - Benzamide - Benzoyl - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid ester - Guanidine - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Organic oxygen compound - Carbonyl group - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as guanidinobenzoic acids and derivatives. These are aromatic compounds containing a guanidine group linked to the benzene ring of a benzoic acid (or a derivative thereof).

Not available