BrCC(=O)NC1CC(=O)C2=CSC=C12

InChIKey=FLRJZFDTWUGDQH-UHFFFAOYSA-N

C9H8BrNO2S

274.13

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Thiophenes Heteroaromatic compounds Secondary carboxylic acid amides Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives Alkyl bromides

Aromatic heteropolycyclic compounds

Aryl alkyl ketone - Thiophene - Heteroaromatic compound - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid derivative - Organoheterocyclic compound - Organic oxide - Organic nitrogen compound - Alkyl halide - Organonitrogen compound - Organobromide - Organohalogen compound - Alkyl bromide - Hydrocarbon derivative - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available