CSC1=NC(C)(C=C2NC(CC2(C)C)=C(C2N=C(O)C(C)=C2C)C(=O)SC(C)(C)C)C(C)(C)C1

InChIKey=FLLCDYGEEUHNBT-UHFFFAOYSA-N

C27H41N3O2S2

503.76

Organic compounds

Organosulfur compounds

Imidothioesters

Imidothiolactones

Not available

Imidothiolactones

Cyclic carboximidic acids Pyrrolidines Pyrrolines Vinylogous amides Amino acids and derivatives Thioesters Carbothioic S-esters Azacyclic compounds Propargyl-type 1,3-dipolar organic compounds Enamines Dialkylamines Sulfenyl compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic heteromonocyclic compounds

Imidothiolactone - Pyrrolidine - Pyrroline - Cyclic carboximidic acid - Vinylogous amide - Amino acid or derivatives - Thiocarboxylic acid ester - Carbothioic s-ester - Carboxylic acid derivative - Secondary aliphatic amine - Enamine - Secondary amine - Thiocarboxylic acid or derivatives - Sulfenyl compound - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Azacycle - Organoheterocyclic compound - Organopnictogen compound - Carbonyl group - Organic oxide - Amine - Organic nitrogen compound - Organonitrogen compound - Hydrocarbon derivative - Organooxygen compound - Organic oxygen compound - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as imidothiolactones. These are analogs of imidolactones where the oxygen atom is replaced by a sulfur atom. They have the general structure RC(=N)SR' where the central carbon atom is part of a ring. R,R' = organyl group.

Not available