CCOC1=CC(OP(=S)(OC)OC)=NC(CC)=N1

InChIKey=FGIWFCGDPUIBEZ-UHFFFAOYSA-N

C10H17N2O4PS

292.29

Organic compounds

Organic acids and derivatives

Organic thiophosphoric acids and derivatives

Thiophosphoric acid esters

Aryl thiophosphates

Pyrimidinyl phosphorothioates

Thiophosphate triesters Alkyl aryl ethers Pyrimidines and pyrimidine derivatives Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

Pyrimidinyl phosphorothioate - Thiophosphate triester - Alkyl aryl ether - Pyrimidine - Heteroaromatic compound - Azacycle - Organoheterocyclic compound - Ether - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as pyrimidinyl phosphorothioates. These are organic compounds containing the thiophosphoric acid functional group or a derivative thereof, with the general structure ROP(OR')(OR'')=S, where R= pyrimidine, R' = organyl group , and R\" = any atom.

CHEBI:82124 : organic thiophosphate
KEGG (C18985) : Organophosphorus insecticides