CCCCC(=O)NNC(=C)CC(=O)NCC1=CC=CC=C1

InChIKey=DVVLFWGEYHVMPN-UHFFFAOYSA-N

C16H23N3O2

289.379

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Beta amino acids and derivatives

N-acyl amines Benzene and substituted derivatives Secondary carboxylic acid amides Carboxylic acid hydrazides Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Beta amino acid or derivatives - Benzenoid - N-acyl-amine - Monocyclic benzene moiety - Secondary carboxylic acid amide - Carboxylic acid hydrazide - Carboxamide group - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as beta amino acids and derivatives. These are amino acids having a (-NH2) group attached to the beta carbon atom.

Not available