OC(=O)CC1=CNC2=C1C=C(O)C=C2

InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-N

C10H9NO3

191.186

Organic compounds

Organoheterocyclic compounds

Indoles and derivatives

Indolyl carboxylic acids and derivatives

Not available

Indole-3-acetic acid derivatives

Hydroxyindoles 3-alkylindoles 1-hydroxy-2-unsubstituted benzenoids Substituted pyrroles Heteroaromatic compounds Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteropolycyclic compounds

Indole-3-acetic acid derivative - 3-alkylindole - Hydroxyindole - Indole - 1-hydroxy-2-unsubstituted benzenoid - Substituted pyrrole - Benzenoid - Pyrrole - Heteroaromatic compound - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Azacycle - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Organic oxide - Organic nitrogen compound - Carbonyl group - Hydrocarbon derivative - Organic oxygen compound - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as indole-3-acetic acid derivatives. These are compounds containing an acetic acid (or a derivative) linked to the C3 carbon atom of an indole.

CHEBI:27823 : indole-3-acetic acids