C[C@H](O)[C@@H](NC(=O)SCC1=CC=CC=C1)C(O)=O

InChIKey=DQIYTXNSTIXVNX-WCBMZHEXSA-N

C12H15NO4S

269.32

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Beta hydroxy acids and derivatives Benzene and substituted derivatives Thiocarbamic acid derivatives Secondary alcohols Sulfenyl compounds Monocarboxylic acids and derivatives Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Alpha-amino acid or derivatives - Beta-hydroxy acid - Monocyclic benzene moiety - Benzenoid - Hydroxy acid - Thiocarbamic acid derivative - Secondary alcohol - Carboxylic acid - Sulfenyl compound - Monocarboxylic acid or derivatives - Alcohol - Organonitrogen compound - Organooxygen compound - Organosulfur compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available