CC(C)(C)OC(=O)NC[C@H](NC(=O)C1=CC=C(C=C1)C#C)C(=O)NO

InChIKey=DKFFAFCKUDAIJM-ZDUSSCGKSA-N

C17H21N3O5

347.371

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides

Hippuric acids and derivatives

N-acyl-alpha amino acids and derivatives Benzoyl derivatives Carbamate esters Secondary carboxylic acid amides Hydroxamic acids Acetylides Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Hippuric acid or derivatives - N-acyl-alpha amino acid or derivatives - N-substituted-alpha-amino acid - Alpha-amino acid or derivatives - Benzoyl - Carbamic acid ester - Secondary carboxylic acid amide - Hydroxamic acid - Carboxamide group - Carboxylic acid derivative - Acetylide - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organic oxygen compound - Organic nitrogen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as hippuric acids and derivatives. These are compounds containing a hippuric acid or a derivative, with a structure characterized the presence of a benzoyl group linked to the N-terminal of a glycine.

Not available