CCC\C=C\C\C=C\C=C\C=N\N1CCCS1(=O)=O

InChIKey=DHZZTXSCNIABAZ-XZTMBADISA-N

C14H22N2O2S

282.4

Organic compounds

Organic nitrogen compounds

Organonitrogen compounds

Hydrazines and derivatives

Hydrazones

N-alkyl sulfonyl hydrazones

Gamma sultams Organosulfonic acids and derivatives N-alkylated hydrazones Azacyclic compounds Organic oxides Hydrocarbon derivatives

Aliphatic heteromonocyclic compounds

N-alkyl sulfonyl hydrazone - Gamma-sultam - Organosulfonic acid or derivatives - Organic sulfonic acid or derivatives - N-alkylated hydrazone - Azacycle - Organoheterocyclic compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as n-alkyl sulfonyl hydrazones. These are organonitrogen compounds containing a hydrazone derivative with the generic structure R1C(R2)=NN(R4)S(R3)(=O)=O where R4 = alkyl group and R1-R3 = H or organyl group.

Not available