CCOC(=O)CCCNC(=S)SCC1CCCO1

InChIKey=DGLBBDTYWLVFEO-UHFFFAOYSA-N

C12H21NO3S2

291.42

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Gamma amino acids and derivatives

Fatty acid esters Oxolanes Dithiocarbamic acid esters Carboxylic acid esters Sulfenyl compounds Oxacyclic compounds Monocarboxylic acids and derivatives Dialkyl ethers Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic heteromonocyclic compounds

Gamma amino acid or derivatives - Fatty acid ester - Fatty acyl - Oxolane - Dithiocarbamic acid ester - Carboxylic acid ester - Organoheterocyclic compound - Sulfenyl compound - Monocarboxylic acid or derivatives - Ether - Dialkyl ether - Oxacycle - Carbonyl group - Organic oxide - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as gamma amino acids and derivatives. These are amino acids having a (-NH2) group attached to the gamma carbon atom.

Not available