[2H]C1([2H])N2N=NC(C2C2=CSC=C12)(C(=O)OCC)C(=O)OCC

InChIKey=DDRSMCBEGFMMEL-BFWBPSQCSA-N

C13H15N3O4S

311.35

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Dicarboxylic acids and derivatives Triazolines Thiophenes Heteroaromatic compounds Carboxylic acid esters Propargyl-type 1,3-dipolar organic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteropolycyclic compounds

Alpha-amino acid or derivatives - Dicarboxylic acid or derivatives - Triazoline - Thiophene - Heteroaromatic compound - Carboxylic acid ester - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Organoheterocyclic compound - Azacycle - Organic nitrogen compound - Organic oxide - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Carbonyl group - Organic oxygen compound - Hydrocarbon derivative - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available