OC(=O)CCC(NC(=O)C(NC(=O)C1=CC=CC=C1)=CC1=CC=CC=C1)C(O)=O

InChIKey=DBEOVTZYUBKJJC-UHFFFAOYSA-N

C21H20N2O6

396.399

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Not available

Peptides

Glutamic acid and derivatives N-acyl-alpha amino acids Hippuric acids and derivatives Cinnamic acid amides Alpha amino acid amides Benzoyl derivatives Dicarboxylic acids and derivatives Secondary carboxylic acid amides Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic homomonocyclic compounds

Alpha peptide - Glutamic acid or derivatives - Hippuric acid or derivatives - N-acyl-alpha-amino acid - N-acyl-alpha amino acid or derivatives - Alpha-amino acid amide - Cinnamic acid amide - Cinnamic acid or derivatives - Alpha-amino acid or derivatives - Benzamide - Benzoic acid or derivatives - Benzoyl - Dicarboxylic acid or derivatives - Benzenoid - Monocyclic benzene moiety - Secondary carboxylic acid amide - Carboxamide group - Carboxylic acid - Organooxygen compound - Carbonyl group - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as peptides. These are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another.

Not available