CCC1=C(C)SC(NC(=O)C2=CC=C(C)O2)=C1C(=O)OC(C)C

InChIKey=CUPMDDZIVZZGIB-UHFFFAOYSA-N

C17H21NO4S

335.42

Organic compounds

Organoheterocyclic compounds

Thiophenes

Thiophene carboxylic acids and derivatives

Not available

Thiophene carboxylic acids and derivatives

Furoic acid and derivatives 2-heteroaryl carboxamides Vinylogous amides Heteroaromatic compounds Secondary carboxylic acid amides Carboxylic acid esters Oxacyclic compounds Monocarboxylic acids and derivatives Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic heteromonocyclic compounds

2-heteroaryl carboxamide - Furoic acid or derivatives - Thiophene carboxylic acid or derivatives - Furan - Heteroaromatic compound - Vinylogous amide - Carboxamide group - Carboxylic acid ester - Secondary carboxylic acid amide - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Oxacycle - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Organopnictogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as thiophene carboxylic acids and derivatives. These are compounds containing a thiophene ring which bears a carboxylic acid group (or a salt/ester thereof).

Not available