CCOC(=O)[C@@H](C)[C@@H](C)C1=CN=CN1

InChIKey=CSVWKDIDYJQFGH-SFYZADRCSA-N

C10H16N2O2

196.25

Organic compounds

Organoheterocyclic compounds

Azoles

Imidazoles

Substituted imidazoles

Imidazolyl carboxylic acids and derivatives

Fatty acid esters Heteroaromatic compounds Carboxylic acid esters Monocarboxylic acids and derivatives Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Imidazolyl carboxylic acid derivative - Fatty acid ester - Fatty acyl - Heteroaromatic compound - Carboxylic acid ester - Carboxylic acid derivative - Azacycle - Monocarboxylic acid or derivatives - Carbonyl group - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as imidazolyl carboxylic acids and derivatives. These are organic compounds containing a carboxylic acid chain (of at least 2 carbon atoms) linked to an imidazole ring.

Not available