CCCN(CCC)OS(=O)C1=CC=C(C=C1)C(=O)SCC

InChIKey=CNWURIGAWIKNJE-UHFFFAOYSA-N

C15H23NO3S2

329.47

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Sulfanylbenzoic acids and derivatives

P-sulfanylbenzoic acids and derivatives

Thiobenzoic acids and derivatives Benzoyl derivatives Thioesters Sulfinic acids and derivatives Carbothioic S-esters Sulfenyl compounds Carboxylic acids and derivatives Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic homomonocyclic compounds

P-sulfanylbenzoic acid or derivatives - Thiobenzoic acid or derivatives - Benzoyl - Carbothioic s-ester - Thiocarboxylic acid ester - Sulfinic acid derivative - Sulfenyl compound - Thiocarboxylic acid or derivatives - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as p-sulfanylbenzoic acids and derivatives. These are benzoic acids (or derivatives) which bear a sulfanyl group (R-SH) attached to the benzene ring at positions 1 and 4, respectively.

Not available