OC(=O)C1=CC=CC(C(O)=O)=C1S(=O)CC1=CC=CC=C1

InChIKey=CKAKBIDWQALZDX-UHFFFAOYSA-N

C15H12O5S

304.32

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Phthalic acid and derivatives

M-phthalic acid and derivatives

O-sulfanylbenzoic acids Benzyl sulfoxides Phenyl sulfoxides Benzoic acids Benzoyl derivatives Dicarboxylic acids and derivatives Sulfoxides Sulfinyl compounds Carboxylic acids Organooxygen compounds Organic oxides Hydrocarbon derivatives

Aromatic homomonocyclic compounds

Meta_phthalic_acid - Benzyl sulfoxide - O-sulfanylbenzoic acid or derivatives - O-sulfanylbenzoic acid - Phenyl sulfoxide - Benzoic acid - Benzoyl - Dicarboxylic acid or derivatives - Sulfoxide - Carboxylic acid derivative - Sulfinyl compound - Carboxylic acid - Organic oxygen compound - Organooxygen compound - Organosulfur compound - Hydrocarbon derivative - Organic oxide - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as m-phthalic acid and derivatives. These are aromatic compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 2.

Not available