CCOP(=O)(CCCN(CC)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCC

InChIKey=CGWCDHWSHVIYSL-UHFFFAOYSA-N

C17H21F17NO5PS

705.36

Organic compounds

Organohalogen compounds

Alkyl halides

Alkyl fluorides

Perfluoroalkyl sulfonic acid and derivatives

Perfluorooctane sulfonic acid and derivatives

Dialkyl alkylphosphonates Phosphonic acid esters Organosulfonamides Organic sulfonamides Aminosulfonyl compounds Organophosphorus compounds Organooxygen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives

Aliphatic acyclic compounds

Perfluorooctane sulfonic acid or derivatives - Dialkyl alkylphosphonate - Phosphonic acid diester - Phosphonic acid ester - Organic sulfonic acid amide - Organosulfonic acid amide - Organophosphonic acid derivative - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Sulfonyl - Aminosulfonyl compound - Organic oxygen compound - Organic nitrogen compound - Organosulfur compound - Organophosphorus compound - Organofluoride - Organic oxide - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as perfluorooctane sulfonic acid and derivatives. These are organic compounds containing an octyl chain attached to the sulfur of a sulfonic acid (or a derivative thereof), where all hydrogens of the octyl chain are replaced by fluorine atoms.

Not available