CCCCCCNC(=O)CNC(=O)C1=CC=CC=C1SC(=O)C1=CC=CC=C1C

InChIKey=CGUZWOCZKURNQH-UHFFFAOYSA-N

C23H28N2O3S

412.55

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides

Hippuric acids and derivatives

N-acyl-alpha amino acids and derivatives Alpha amino acid amides O-sulfanylbenzoic acids and derivatives Thiobenzoic acids and derivatives Aryl thioethers Benzoyl derivatives Toluenes Thioesters Secondary carboxylic acid amides Carbothioic S-esters Sulfenyl compounds Organic oxides Carbonyl compounds Organonitrogen compounds Organopnictogen compounds Hydrocarbon derivatives

Aromatic homomonocyclic compounds

Hippuric acid or derivatives - N-acyl-alpha amino acid or derivatives - Alpha-amino acid amide - N-substituted-alpha-amino acid - Alpha-amino acid or derivatives - O-sulfanylbenzoic acid or derivatives - Thiobenzoic acid or derivatives - Aryl thioether - Benzoyl - Toluene - Carboxamide group - Carbothioic s-ester - Thiocarboxylic acid ester - Secondary carboxylic acid amide - Carboxylic acid derivative - Sulfenyl compound - Thiocarboxylic acid or derivatives - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Organosulfur compound - Organonitrogen compound - Organooxygen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as hippuric acids and derivatives. These are compounds containing a hippuric acid or a derivative, with a structure characterized the presence of a benzoyl group linked to the N-terminal of a glycine.

Not available