CCCCCSCC(=O)N[C@H]1CCOC1=O

InChIKey=CFVHIEZUHHLQFO-VIFPVBQESA-N

C11H19NO3S

245.34

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives - Alpha amino acids and derivatives

N-acyl-alpha amino acids and derivatives

Alpha amino acid esters Gamma butyrolactones Oxolanes Secondary carboxylic acid amides Carboxylic acid esters Sulfenyl compounds Oxacyclic compounds Monocarboxylic acids and derivatives Dialkylthioethers Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic heteromonocyclic compounds

Alpha-amino acid ester - N-acyl-alpha amino acid or derivatives - Gamma butyrolactone - Oxolane - Carboxamide group - Carboxylic acid ester - Lactone - Secondary carboxylic acid amide - Sulfenyl compound - Thioether - Monocarboxylic acid or derivatives - Dialkylthioether - Organoheterocyclic compound - Oxacycle - Organic oxide - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Carbonyl group - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as n-acyl-alpha amino acids and derivatives. These are compounds containing an alpha amino acid (or a derivative thereof) which bears an acyl group at its terminal nitrogen atom.

Not available