OC1C=C(C(O)C(O)C1O)C(O)=O

InChIKey=CCHYYLPXFCHJRJ-UHFFFAOYSA-N

C7H10O6

190.151

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Alcohols and polyols

Cyclic alcohols and derivatives - Cyclitols and derivatives

Shikimic acids and derivatves

Beta hydroxy acids and derivatives Secondary alcohols Polyols Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic homomonocyclic compounds

Shikimic acid or derivatives - Beta-hydroxy acid - Hydroxy acid - Secondary alcohol - Polyol - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic oxide - Hydrocarbon derivative - Carbonyl group - Aliphatic homomonocyclic compound

This compound belongs to the class of organic compounds known as shikimic acids and derivatves. These are cyclitols containing a cyclohexanecarboxylic acid substituted with three hydroxyl groups at positions 3, 4, and 5.

Not available