CC(=O)OC[C@H]1O[C@H]([C@H](OC(C)=O)[C@@H]1OC(C)=O)N1C(=O)CSC1=S

InChIKey=CCCZWKVNGPTQGA-OJAKKHQRSA-N

C14H17NO8S2

391.41

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbohydrates and carbohydrate conjugates

Glycosyl compounds

Glycosylamines

Tricarboxylic acids and derivatives Thiazolidinethiones Monosaccharides Tetrahydrofurans Cyclic dithiocarbamic acid esters Carboxylic acid esters Oxacyclic compounds Azacyclic compounds Organosulfur compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic heteromonocyclic compounds

N-glycosyl compound - Tricarboxylic acid or derivatives - Monosaccharide - Thiazolidinethione - Tetrahydrofuran - Thiazolidine - Dithiocarbamic acid ester - Cyclic dithiocarbamic acid ester - Carboxylic acid ester - Carboxylic acid derivative - Oxacycle - Azacycle - Organoheterocyclic compound - Organosulfur compound - Organonitrogen compound - Organic nitrogen compound - Organic oxide - Organopnictogen compound - Carbonyl group - Hydrocarbon derivative - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as glycosylamines. These are compounds consisting of an amine with a beta-N-glycosidic bond to a carbohydrate, thus forming a cyclic hemiaminal ether bond (alpha-amino ether).

Not available