CC(C)CC(O)C1=NC(C)=C(N=C1C)C(=O)CC(C)C

InChIKey=BTMMZKJGOKVAPR-UHFFFAOYSA-N

C16H26N2O2

278.396

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Ketones - Aryl ketones

Aryl alkyl ketones

Pyrazines Heteroaromatic compounds Secondary alcohols Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Aromatic alcohols

Aromatic heteromonocyclic compounds

Aryl alkyl ketone - Pyrazine - Heteroaromatic compound - Secondary alcohol - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Aromatic alcohol - Organonitrogen compound - Alcohol - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group.

Not available