CC1(C)OC1C(=O)NCCNC(=O)C1OC1(C)C

InChIKey=BOMAGJANFAULSL-UHFFFAOYSA-N

C12H20N2O4

256.302

Organic compounds

Organoheterocyclic compounds

Epoxides

Oxirane carboxylic acids and derivatives

Not available

Oxirane carboxylic acids and derivatives

Secondary carboxylic acid amides Oxacyclic compounds Dialkyl ethers Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic heteromonocyclic compounds

Oxirane carboxylic acid or derivatives - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid derivative - Dialkyl ether - Ether - Oxacycle - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Carbonyl group - Organopnictogen compound - Hydrocarbon derivative - Organic oxide - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as oxirane carboxylic acids and derivatives. These are compounds containing an oxirane ring bearing a carboxylic acid group (or a derivative thereof).

Not available