CC(C)(C)NC(=O)[C@@H]1CC[C@@](C)(C(O)=O)C1(C)C

InChIKey=BNLAQWKIJVEPDI-XPTSAGLGSA-N

C14H25NO3

255.358

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Carboxylic acid derivatives

Carboxylic acid amides

Secondary carboxylic acid amides

Monocarboxylic acids and derivatives Carboxylic acids Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic homomonocyclic compounds

Secondary carboxylic acid amide - Monocarboxylic acid or derivatives - Carboxylic acid - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic homomonocyclic compound

This compound belongs to the class of organic compounds known as secondary carboxylic acid amides. These are compounds containing a secondary carboxylic acid amide functional group, with the general structure RC(=O)N(R')H (R,R'=alkyl, aryl).

Not available