OC(=O)C(NC(=O)C1=CC=CC=C1)C(O)=O

InChIKey=BHUPBJGOGXIXMY-UHFFFAOYSA-N

C10H9NO5

223.184

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides - Hippuric acids and derivatives

Hippuric acids

N-acyl-alpha amino acids Benzoyl derivatives Dicarboxylic acids and derivatives 1,3-dicarbonyl compounds Secondary carboxylic acid amides Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aromatic homomonocyclic compounds

Hippuric acid - N-acyl-alpha-amino acid - N-acyl-alpha amino acid or derivatives - Alpha-amino acid or derivatives - Benzoyl - Dicarboxylic acid or derivatives - 1,3-dicarbonyl compound - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid - Carboxylic acid derivative - Hydrocarbon derivative - Organic oxide - Organic nitrogen compound - Carbonyl group - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound

This compound belongs to the class of organic compounds known as hippuric acids. These are compounds containing hippuric acid, which consists of a of a benzoyl group linked to the N-terminal of a glycine.

Not available