CC1=CSC(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=N1

InChIKey=AWYNBBQQYQVYSX-UHFFFAOYSA-N

C13H5F17N2OS

560.23

Organic compounds

Organohalogen compounds

Alkyl halides

Alkyl fluorides

Perfluoroalkyl carboxylic acid and derivatives

Perfluorooctanoic acid and derivatives

N-arylamides 2,4-disubstituted thiazoles Fatty amides Heteroaromatic compounds Secondary carboxylic acid amides Azacyclic compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Perfluorooctanoic acid or derivatives - N-arylamide - 2,4-disubstituted 1,3-thiazole - Fatty amide - Fatty acyl - Azole - Heteroaromatic compound - Thiazole - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid derivative - Azacycle - Organoheterocyclic compound - Organonitrogen compound - Organofluoride - Hydrocarbon derivative - Organic nitrogen compound - Organic oxide - Carbonyl group - Organooxygen compound - Organic oxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as perfluorooctanoic acid and derivatives. These are organic compounds containing an octyl chain attached to the C-alpha of a carboxylic acid group (or a derivative thereof), where all hydrogens of the octyl chain are replaced by fluorine atoms.

Not available