CCCCC[C@H](CC(=O)NO)C(=O)N1NCCC[C@H]1C(=O)N(CC)CC

InChIKey=ANUFIALTOJANCR-CABCVRRESA-N

C18H34N4O4

370.494

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives

Alpha amino acids and derivatives

Diazinanes Tertiary carboxylic acid amides Hydroxamic acids Carboxylic acid hydrazides Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic heteromonocyclic compounds

Alpha-amino acid or derivatives - 1,2-diazinane - Tertiary carboxylic acid amide - Carboxamide group - Carboxylic acid hydrazide - Hydroxamic acid - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Carbonyl group - Aliphatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof.

Not available