OC(=O)C(CC1=CC=CC=C1)(CC1=NC=C(O)C=C1)NC(=O)C1=CC=CC=C1

InChIKey=AMLVSFPQUDZDGA-UHFFFAOYSA-N

C22H20N2O4

376.412

Organic compounds

Benzenoids

Benzene and substituted derivatives

Benzoic acids and derivatives

Benzamides - Hippuric acids and derivatives

Hippuric acids

N-acyl-alpha amino acids Phenylpropanoic acids Amphetamines and derivatives Benzoyl derivatives Hydroxypyridines Heteroaromatic compounds Secondary carboxylic acid amides Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteromonocyclic compounds

Hippuric acid - N-acyl-alpha-amino acid - N-acyl-alpha amino acid or derivatives - 3-phenylpropanoic-acid - Alpha-amino acid or derivatives - Amphetamine or derivatives - Benzoyl - Hydroxypyridine - Pyridine - Heteroaromatic compound - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Azacycle - Organoheterocyclic compound - Hydrocarbon derivative - Organic oxygen compound - Organic nitrogen compound - Organic oxide - Organopnictogen compound - Carbonyl group - Organonitrogen compound - Organooxygen compound - Aromatic heteromonocyclic compound

This compound belongs to the class of organic compounds known as hippuric acids. These are compounds containing hippuric acid, which consists of a of a benzoyl group linked to the N-terminal of a glycine.

Not available