CN(C)C(=S)SCC1=C(N2[C@H](SC1)[C@H](NC(=O)CSCC1=CC=CC=C1)C2=O)C(O)=O

InChIKey=AMHZVJJYDORHJA-CRAIPNDOSA-N

C20H23N3O4S4

497.66

Organic compounds

Organoheterocyclic compounds

Lactams

Beta lactams

Cephems

Cephalosporins

N-acyl-alpha amino acids and derivatives Benzene and substituted derivatives 1,3-thiazines Tertiary carboxylic acid amides Dithiocarbamic acid esters Secondary carboxylic acid amides Azetidines Thiohemiaminal derivatives Sulfenyl compounds Monocarboxylic acids and derivatives Dialkylthioethers Carboxylic acids Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aromatic heteropolycyclic compounds

Cephalosporin - N-acyl-alpha amino acid or derivatives - Alpha-amino acid or derivatives - Benzenoid - Monocyclic benzene moiety - Meta-thiazine - Dithiocarbamic acid ester - Tertiary carboxylic acid amide - Secondary carboxylic acid amide - Carboxamide group - Azetidine - Azacycle - Dialkylthioether - Sulfenyl compound - Hemithioaminal - Thioether - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aromatic heteropolycyclic compound

This compound belongs to the class of organic compounds known as cephalosporins. These are compounds containing a 1,2-thiazine fused to a 2-azetidinone to for a oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid moiety or a derivative thereof.

Not available