COS(=O)C(C)(C)C(=O)N\C(N)=C\C(=O)C(C)(C)C

InChIKey=AMACBLDLPLTKCZ-VQHVLOKHSA-N

C12H22N2O4S

290.38

Organic compounds

Organic oxygen compounds

Organooxygen compounds

Carbonyl compounds

Alpha,beta-unsaturated carbonyl compounds - Alpha,beta-unsaturated ketones

Enones

Vinylogous amides Acryloyl compounds Secondary carboxylic acid amides Ketones Ketene acetals Alkanesulfinic acids and derivatives Organosulfur compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives

Aliphatic acyclic compounds

Acryloyl-group - Enone - Vinylogous amide - Carboxamide group - Alkanesulfinic acid or derivatives - Sulfinic acid derivative - Secondary carboxylic acid amide - Ketone - Ketene acetal or derivatives - Carboxylic acid derivative - Organosulfur compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organic nitrogen compound - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as enones. These are compounds containing the enone functional group, with the structure RC(=O)CR'.

Not available