OC(=O)CC[C@H](NC=O)C(O)=O

InChIKey=ADZLWSMFHHHOBV-BYPYZUCNSA-N

C6H9NO5

175.14

Organic compounds

Organic acids and derivatives

Carboxylic acids and derivatives

Amino acids, peptides, and analogues

Amino acids and derivatives - Alpha amino acids and derivatives

Glutamic acid and derivatives

N-acyl-L-alpha-amino acids N-formyl-alpha amino acids Fatty acids and conjugates Dicarboxylic acids and derivatives Secondary carboxylic acid amides Carboxylic acids Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Aliphatic acyclic compounds

Glutamic acid or derivatives - N-acyl-l-alpha-amino acid - N-formyl-alpha-amino acid - N-formyl-alpha amino acid or derivatives - Dicarboxylic acid or derivatives - Fatty acid - Secondary carboxylic acid amide - Carboxamide group - Carboxylic acid - Organopnictogen compound - Carbonyl group - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Aliphatic acyclic compound

This compound belongs to the class of organic compounds known as glutamic acid and derivatives. These are compounds containing glutamic acid or a derivative thereof resulting from reaction of glutamic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom.

CHEBI:48309 : N-acyl-L-glutamic acid - N-formyl amino acid